CAS 103889-37-8 appears in our catalog under these names: 1–Chloro–3–fluoro–2–(trifluoromethyl)benzene, 1-Chloro-3-fluoro-2-(trifluoromethyl)benzene 95%, 1-Chloro-3-fluoro-2-(trifluoromethyl)benzene, 95%, 95%, 1-Chloro-3-fluoro-2-trifluoromethyl-benzene, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
1-chloro-3-fluoro-2-(trifluoromethyl)benzene (CAS 103889-37-8) is a chemical compound with the molecular formula C7H3ClF4 and a molecular weight of 198.54 g/mol. IUPAC name: 1-chloro-3-fluoro-2-(trifluoromethyl)benzene. InChIKey: ILUCOEVDXAZECW-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF4 |
|---|---|
| Molecular weight | 198.54 g/mol |
| IUPAC name | 1-chloro-3-fluoro-2-(trifluoromethyl)benzene |
| InChIKey | ILUCOEVDXAZECW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(F)(F)F)F |
Computed by PubChem (NCBI)