2-Chloro-4-isopropoxy-5-nitropyridine, 97%
cas: 1462950-90-8 — see every product listed under this CAS number, including other names
2-Chloro-4-isopropoxy-5-nitropyridine, 97% (CAS 1462950-90-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A534870-250mg |
| cas | 1462950-90-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2389.56 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 2493.20 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 719.77 Pln | |
| BLDpharm | 5g | 2341.42 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1398.48 Pln | |
| Fluorochem | 5g | 4616.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-nitro-4-propan-2-yloxypyridine (CAS 1462950-90-8) is a chemical compound with the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. IUPAC name: 2-chloro-5-nitro-4-propan-2-yloxypyridine. InChIKey: KRDGKHZNAHNYKH-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O3 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 2-chloro-5-nitro-4-propan-2-yloxypyridine |
| InChIKey | KRDGKHZNAHNYKH-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=NC=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)