cas: 114997-91-0 — see every product listed under this CAS number, including other names
2-Chloro-5-(trifluoromethyl)benzo[d]oxazole, 97% (CAS 114997-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F227664-100MG |
| cas | 114997-91-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 1060.06 Pln | |
| Fluorochem | 5g | 5017.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-(trifluoromethyl)-1,3-benzoxazole (CAS 114997-91-0) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)-1,3-benzoxazole. InChIKey: USIZXRJQPABFJF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | USIZXRJQPABFJF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(O2)Cl |
Computed by PubChem (NCBI)