Products 56309-57-0
CAS 56309-57-0 appears in our catalog under these names: Regorafenib Impurity 38, 1-Chloro-3-isocyanato-5-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-3-isocyanato-5-(trifluoromethyl)benzene (CAS 56309-57-0) is a chemical compound with the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. IUPAC name: 1-chloro-3-isocyanato-5-(trifluoromethyl)benzene. InChIKey: YBLHAAVYDYIUCM-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3NO |
|---|---|
| Molecular weight | 221.56 g/mol |
| IUPAC name | 1-chloro-3-isocyanato-5-(trifluoromethyl)benzene |
| InChIKey | YBLHAAVYDYIUCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N=C=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)