cas: 21900-51-6 — see every product listed under this CAS number, including other names
2-Chloro-5-fluorobenzoyl chloride 98% (CAS 21900-51-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A239606-1g |
| cas | 21900-51-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 25g | 3835.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A239606 |
2-chloro-5-fluorobenzoyl chloride (CAS 21900-51-6) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-5-fluorobenzoyl chloride. InChIKey: SGZSJPBASHYOHQ-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-5-fluorobenzoyl chloride |
| InChIKey | SGZSJPBASHYOHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)Cl)Cl |
Computed by PubChem (NCBI)