cas: 54120-91-1 — see every product listed under this CAS number, including other names
2-Chloro-5-nitrobenzo[d]oxazole, 96% (CAS 54120-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229866-100MG |
| cas | 54120-91-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 997.58 Pln | |
| Fluorochem | 5g | 2382.51 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-5-nitro-1,3-benzoxazole (CAS 54120-91-1) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 2-chloro-5-nitro-1,3-benzoxazole. InChIKey: JDESVZPWUYUPRC-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 2-chloro-5-nitro-1,3-benzoxazole |
| InChIKey | JDESVZPWUYUPRC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])N=C(O2)Cl |
Computed by PubChem (NCBI)