CAS 178747-55-2 appears in our catalog under these names: 3-Chloro-7-nitro-1,2-benzisoxazole, 95%, 3–Chloro–7–nitro–1,2–benzisoxazole. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
3-chloro-7-nitro-1,2-benzoxazole (CAS 178747-55-2) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 3-chloro-7-nitro-1,2-benzoxazole. InChIKey: QYZFVJOFHSZWDM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 3-chloro-7-nitro-1,2-benzoxazole |
| InChIKey | QYZFVJOFHSZWDM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])ON=C2Cl |
Computed by PubChem (NCBI)