Products 3017270-52-6
CAS 3017270-52-6 is the registry number for 4-Chlorofuro[2,3-d]pyridazine-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-chlorofuro[2,3-d]pyridazine-2-carboxylic acid (CAS 3017270-52-6) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 4-chlorofuro[2,3-d]pyridazine-2-carboxylic acid. InChIKey: YIRXQIQGMGIUKJ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 4-chlorofuro[2,3-d]pyridazine-2-carboxylic acid |
| InChIKey | YIRXQIQGMGIUKJ-UHFFFAOYSA-N |
| SMILES | C1=C(OC2=CN=NC(=C21)Cl)C(=O)O |
Computed by PubChem (NCBI)