CAS 68622-16-2 is the registry number for 2-Chloro-5-nitrophenyl isocyanate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-2-isocyanato-4-nitrobenzene (CAS 68622-16-2) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 1-chloro-2-isocyanato-4-nitrobenzene. InChIKey: DZMSHKRHIIDOIZ-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 1-chloro-2-isocyanato-4-nitrobenzene |
| InChIKey | DZMSHKRHIIDOIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N=C=O)Cl |
Computed by PubChem (NCBI)