CAS 116549-11-2 appears in our catalog under these names: 5-Chloro-6-nitro-1,3-benzoxazole, 95%, 5-Chloro-6-nitro-1,3-benzoxazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
5-chloro-6-nitro-1,3-benzoxazole (CAS 116549-11-2) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 5-chloro-6-nitro-1,3-benzoxazole. InChIKey: KYZBUAFFLVOXMM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 5-chloro-6-nitro-1,3-benzoxazole |
| InChIKey | KYZBUAFFLVOXMM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)[N+](=O)[O-])OC=N2 |
Computed by PubChem (NCBI)