CAS 1356111-15-3 is the registry number for 5-Chloro-7-nitro-1,3-benzoxazole, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-chloro-7-nitro-1,3-benzoxazole (CAS 1356111-15-3) is a chemical compound with the molecular formula C7H3ClN2O3 and a molecular weight of 198.56 g/mol. IUPAC name: 5-chloro-7-nitro-1,3-benzoxazole. InChIKey: KNEAFDRPEPJZOM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClN2O3 |
|---|---|
| Molecular weight | 198.56 g/mol |
| IUPAC name | 5-chloro-7-nitro-1,3-benzoxazole |
| InChIKey | KNEAFDRPEPJZOM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CO2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)