2-Chloro-5-phenyl-1,3,4-thiadiazole, 97%
cas: 13373-11-0 — see every product listed under this CAS number, including other names
2-Chloro-5-phenyl-1,3,4-thiadiazole, 97% (CAS 13373-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A245245-250mg |
| cas | 13373-11-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 887.69 Pln | |
| Ambeed | 5g | 2567.56 Pln | |
| Ambeed | 10g | 4469.94 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 947.47 Pln | |
| BLDpharm | 5g | 2763.50 Pln | |
| BLDpharm | 10g | 4818.33 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 914.28 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-5-phenyl-1,3,4-thiadiazole (CAS 13373-11-0) is a chemical compound with the molecular formula C8H5ClN2S and a molecular weight of 196.66 g/mol. IUPAC name: 2-chloro-5-phenyl-1,3,4-thiadiazole. InChIKey: ASSPGHHANNDMET-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2S |
|---|---|
| Molecular weight | 196.66 g/mol |
| IUPAC name | 2-chloro-5-phenyl-1,3,4-thiadiazole |
| InChIKey | ASSPGHHANNDMET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(S2)Cl |
Computed by PubChem (NCBI)