cas: 1221171-70-5 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethoxy)pyridine 95% (CAS 1221171-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A191630-100g |
| cas | 1221171-70-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 21057.31 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 581.75 Pln | |
| Ambeed | 5g | 1505.12 Pln | |
| Ambeed | 10g | 2806.75 Pln | |
| Ambeed | 25g | 6628.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A191630 |
2-chloro-6-(trifluoromethoxy)pyridine (CAS 1221171-70-5) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-6-(trifluoromethoxy)pyridine. InChIKey: GZFNUCAMADABAO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethoxy)pyridine |
| InChIKey | GZFNUCAMADABAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)