cas: 1221171-70-5 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethoxy)pyridine, 97% (CAS 1221171-70-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F324417-1G |
| cas | 1221171-70-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 466.52 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 10g | 2799.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-chloro-6-(trifluoromethoxy)pyridine (CAS 1221171-70-5) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-6-(trifluoromethoxy)pyridine. InChIKey: GZFNUCAMADABAO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethoxy)pyridine |
| InChIKey | GZFNUCAMADABAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)