cas: 1221171-70-5 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethoxy)pyridine, 97%, 97% (CAS 1221171-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127S2-100mg |
| cas | 1221171-70-5 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3851.60 Pln | |
| Chemat | 50g | 6611.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-(trifluoromethoxy)pyridine (CAS 1221171-70-5) is a chemical compound with the molecular formula C6H3ClF3NO and a molecular weight of 197.54 g/mol. IUPAC name: 2-chloro-6-(trifluoromethoxy)pyridine. InChIKey: GZFNUCAMADABAO-UHFFFAOYSA-N.
| Molecular formula | C6H3ClF3NO |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethoxy)pyridine |
| InChIKey | GZFNUCAMADABAO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)