cas: 796090-23-8 — see every product listed under this CAS number, including other names
2-Chloro-6-(trifluoromethyl)isonicotinic Acid, 96%, 96% (CAS 796090-23-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G97V-100g |
| cas | 796090-23-8 |
| size | 100g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 9054.80 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 25g | 2872.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 796090-23-8) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: OMXMPMNUSMLQQS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | OMXMPMNUSMLQQS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)