cas: 55687-11-1 — see every product listed under this CAS number, including other names
2-Chloro-6-methoxyquinoxaline, 97% (CAS 55687-11-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210243-50MG |
| cas | 55687-11-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 206.20 Pln | |
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 1190.22 Pln | |
| Fluorochem | 5g | 5693.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-6-methoxyquinoxaline (CAS 55687-11-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-6-methoxyquinoxaline. InChIKey: SXUWYCHACCYVMS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-6-methoxyquinoxaline |
| InChIKey | SXUWYCHACCYVMS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=C(N=C2C=C1)Cl |
Computed by PubChem (NCBI)