CAS 850424-11-2 appears in our catalog under these names: 2-Chloro-6-methoxyquinazoline, 95%, Quinazoline, 2-chloro-6-methoxy-, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
2-chloro-6-methoxyquinazoline (CAS 850424-11-2) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-chloro-6-methoxyquinazoline. InChIKey: NKHDIWOWDNCSLS-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-chloro-6-methoxyquinazoline |
| InChIKey | NKHDIWOWDNCSLS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CN=C(N=C2C=C1)Cl |
Computed by PubChem (NCBI)