cas: 26820-34-8 — see every product listed under this CAS number, including other names
2-Chloro-6-methyl-5-nitronicotinonitrile, 98%, 98% (CAS 26820-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN2S-100mg |
| cas | 26820-34-8 |
| size | 100mg |
| availability | 0.39g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 294.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-methyl-5-nitropyridine-3-carbonitrile (CAS 26820-34-8) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 2-chloro-6-methyl-5-nitropyridine-3-carbonitrile. InChIKey: FVZWFEILQHGLRN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 2-chloro-6-methyl-5-nitropyridine-3-carbonitrile |
| InChIKey | FVZWFEILQHGLRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=N1)Cl)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)