Products 1072944-44-5
CAS 1072944-44-5 appears in our catalog under these names: 7-Chloro-3-nitroimidazo[1,2-a]pyridine, 96%, 7-Chloro-3-nitroimidazo(1,2-a)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
7-chloro-3-nitroimidazo[1,2-a]pyridine (CAS 1072944-44-5) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloro-3-nitroimidazo[1,2-a]pyridine. InChIKey: OUZJWCHBKWOMPF-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloro-3-nitroimidazo[1,2-a]pyridine |
| InChIKey | OUZJWCHBKWOMPF-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=C2[N+](=O)[O-])C=C1Cl |
Computed by PubChem (NCBI)