CAS 918519-53-6 appears in our catalog under these names: 4-Chloro-3-nitro-1h-pyrrolo[2,3-b]pyridine, 95%, 4-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine, 98%, 98%, 4-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 918519-53-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: KCCXAUDAHDKANR-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 4-chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | KCCXAUDAHDKANR-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Cl)C(=CN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)