CAS 1053656-45-3 appears in our catalog under these names: 1-Chloro-7-nitroh-pyrrolo[1,2-a]pyrazine, 95%, 1-Chloro-7-nitropyrrolo[1,2-a]pyrazine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1-chloro-7-nitropyrrolo[1,2-a]pyrazine (CAS 1053656-45-3) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 1-chloro-7-nitropyrrolo[1,2-a]pyrazine. InChIKey: OTWHUHVUMPHTOY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 1-chloro-7-nitropyrrolo[1,2-a]pyrazine |
| InChIKey | OTWHUHVUMPHTOY-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C2C(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)