CAS 1936087-76-1 appears in our catalog under these names: 8-Chloro-6-nitro-imidazo[1,2-a]pyridine, 95%, 8-Chloro-6-nitroimidazo[1,2-a]pyridine 95%, 8-Chloro-6-nitro-imidazo[1,2-a]pyridine, 95%+, 95%+. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg.
8-chloro-6-nitroimidazo[1,2-a]pyridine (CAS 1936087-76-1) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 8-chloro-6-nitroimidazo[1,2-a]pyridine. InChIKey: AUVYSHCOUJTHLK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 8-chloro-6-nitroimidazo[1,2-a]pyridine |
| InChIKey | AUVYSHCOUJTHLK-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)