CAS 1416372-61-6 appears in our catalog under these names: 7-Chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid, 95%, 7-Chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid, 96%, 96%, 7-Chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
7-chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid (CAS 1416372-61-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: VEVCJRCPPKTPJN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | VEVCJRCPPKTPJN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)C(=O)O)C=C1Cl |
Computed by PubChem (NCBI)