cas: 5955-72-6 — see every product listed under this CAS number, including other names
2-Chloro-6-nitro-1H-benzo[d]imidazole, 95%, 95% (CAS 5955-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EE3N-100mg |
| cas | 5955-72-6 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1245.20 Pln | |
| Chemat | 10g | 2426.00 Pln | |
| Chemat | 25g | 4792.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-6-nitro-1H-benzimidazole (CAS 5955-72-6) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 2-chloro-6-nitro-1H-benzimidazole. InChIKey: GWSMACGSFHRVFA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 2-chloro-6-nitro-1H-benzimidazole |
| InChIKey | GWSMACGSFHRVFA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=N2)Cl |
Computed by PubChem (NCBI)