2-Chloro-6-nitrobenzoic acid 98%
cas: 5344-49-0 — see every product listed under this CAS number, including other names
2-Chloro-6-nitrobenzoic acid 98% (CAS 5344-49-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137181-5g |
| cas | 5344-49-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1405.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A137181 |
2-chloro-6-nitrobenzoic acid (CAS 5344-49-0) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 2-chloro-6-nitrobenzoic acid. InChIKey: JYHOMEFOTKWQPN-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 2-chloro-6-nitrobenzoic acid |
| InChIKey | JYHOMEFOTKWQPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)