CAS 7748-57-4 is the registry number for 5-Chloro-6-nitro-1,3-benzodioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-chloro-6-nitro-1,3-benzodioxole (CAS 7748-57-4) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 5-chloro-6-nitro-1,3-benzodioxole. InChIKey: GWDKDQSLKYJHKS-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 5-chloro-6-nitro-1,3-benzodioxole |
| InChIKey | GWDKDQSLKYJHKS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)