CAS 127437-44-9 appears in our catalog under these names: 6-Chloropyridine-2,3-dicarboxylic acid, 95%, 6-Chloropyridine-2,3-dicarboxylic acid, 6-Chloropyridine-2,3-dicarboxylic acid 97%, 6-Chloropyridine-2,3-dicarboxylic acid, 97%, 97%, 6-Chloropyridine-2,3-dicarboxylic acid, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 2,5g, 5g, 10g, 25g.
6-chloropyridine-2,3-dicarboxylic acid (CAS 127437-44-9) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 6-chloropyridine-2,3-dicarboxylic acid. InChIKey: UZSYXDLIFFSYNQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 6-chloropyridine-2,3-dicarboxylic acid |
| InChIKey | UZSYXDLIFFSYNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)