CAS 50353-00-9 is the registry number for 2-nitrophenyl carbonochloridate. Offered by: Chemat Brand. Available pack sizes: on request.
(2-nitrophenyl) carbonochloridate (CAS 50353-00-9) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: (2-nitrophenyl) carbonochloridate. InChIKey: FHLXUWOHGKLDNF-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | (2-nitrophenyl) carbonochloridate |
| InChIKey | FHLXUWOHGKLDNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC(=O)Cl |
Computed by PubChem (NCBI)