CAS 2516-95-2 appears in our catalog under these names: 5–Chloro–2–nitrobenzoic acid, 5-Chloro-2-nitrobenzoic acid, 5-Chloro-2-nitrobenzoic acid, 99% , 5-Chloro-2-nitrobenzoic acid, 99%, 5-Chloro-2-nitrobenzoic acid 98%. Offered by: GLPBio, Biosynth, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 500g, 1kg, 0,5kg, 5g, 25g, 10g, 1000g.
5-chloro-2-nitrobenzoic acid (CAS 2516-95-2) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 5-chloro-2-nitrobenzoic acid. InChIKey: ZKUYSJHXBFFGPU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 5-chloro-2-nitrobenzoic acid |
| InChIKey | ZKUYSJHXBFFGPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)