CAS 34662-36-7 appears in our catalog under these names: 3-Chloro-5-nitrobenzoic acid, 98%, 3–Chloro–5–nitrobenzoic acid, 3-Chloro-5-nitrobenzoic acid, 3-chloro-5-nitro-benzoic acid, 98%, 98%, 3-Chloro-5-nitrobenzoic acid, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 50g, 250mg.
3-chloro-5-nitrobenzoic acid (CAS 34662-36-7) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 3-chloro-5-nitrobenzoic acid. InChIKey: YLQAJBKACBLUCM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 3-chloro-5-nitrobenzoic acid |
| InChIKey | YLQAJBKACBLUCM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)