cas: 66217-55-8 — see every product listed under this CAS number, including other names
2-Cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 66217-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1004786-1g |
| cas | 66217-55-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 242.44 Pln | |
| Ambeed | 25g | 832.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1004786 |
2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 66217-55-8) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BLLUYOVVBCMKHV-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BLLUYOVVBCMKHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCC2 |
Computed by PubChem (NCBI)