cas: 66217-55-8 — see every product listed under this CAS number, including other names
CYCLOPENTYLBORONIC ACID PINACOL ESTER, 95% (CAS 66217-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F843267-1G |
| cas | 66217-55-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 25g | 784.12 Pln | |
| Fluorochem | 100g | 2424.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 66217-55-8) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BLLUYOVVBCMKHV-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BLLUYOVVBCMKHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCC2 |
Computed by PubChem (NCBI)