cas: 66217-55-8 — see every product listed under this CAS number, including other names
2-Cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95.0%(GC)(T) (CAS 66217-55-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C4164-1G |
| cas | 66217-55-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 197.02 Pln | |
| TCI | 5g | 437.97 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC)(T) |
2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 66217-55-8) is a chemical compound with the molecular formula C11H21BO2 and a molecular weight of 196.10 g/mol. IUPAC name: 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BLLUYOVVBCMKHV-UHFFFAOYSA-N.
| Molecular formula | C11H21BO2 |
|---|---|
| Molecular weight | 196.10 g/mol |
| IUPAC name | 2-cyclopentyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BLLUYOVVBCMKHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCC2 |
Computed by PubChem (NCBI)