cas: 1183614-12-1 — see every product listed under this CAS number, including other names
2-Cyclopentylthiazole-5-carboxylic acid, 97% (CAS 1183614-12-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A843264-5g |
| cas | 1183614-12-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 21194.95 Pln | |
| AmBeed | 10g | 25634.77 Pln | |
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1382.86 Pln | |
| Fluorochem | 500mg | 2241.94 Pln | |
| Fluorochem | 1g | 3298.86 Pln | |
| Fluorochem | 5g | 9588.31 Pln | |
| Fluorochem | 10g | 15945.44 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-cyclopentyl-1,3-thiazole-5-carboxylic acid (CAS 1183614-12-1) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 2-cyclopentyl-1,3-thiazole-5-carboxylic acid. InChIKey: XEXVBUGDRXZQCC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2-cyclopentyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | XEXVBUGDRXZQCC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)