CAS 1183614-12-1 appears in our catalog under these names: 2-Cyclopentylthiazole-5-carboxylic acid, 97%, 2-Cyclopentylthiazole-5-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
2-cyclopentyl-1,3-thiazole-5-carboxylic acid (CAS 1183614-12-1) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 2-cyclopentyl-1,3-thiazole-5-carboxylic acid. InChIKey: XEXVBUGDRXZQCC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2-cyclopentyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | XEXVBUGDRXZQCC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)