2-Cyclopropyl-6-methylbenzoic acid, 95%
cas: 1864695-97-5 — see every product listed under this CAS number, including other names
2-Cyclopropyl-6-methylbenzoic acid, 95% (CAS 1864695-97-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1020390-100mg |
| cas | 1864695-97-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1249.25 Pln | |
| Ambeed | 250mg | 2066.94 Pln | |
| Ambeed | 1g | 4464.38 Pln | |
| BLDpharm | 100mg | 1341.77 Pln | |
| BLDpharm | 250mg | 2219.24 Pln | |
| BLDpharm | 1g | 4807.22 Pln | |
| Chemat | 100mg | 1014.80 Pln | |
| Chemat | 250mg | 1682.00 Pln | |
| Chemat | 1g | 4437.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-cyclopropyl-6-methylbenzoic acid (CAS 1864695-97-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 2-cyclopropyl-6-methylbenzoic acid. InChIKey: NLYLKQOLEHUEKT-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 2-cyclopropyl-6-methylbenzoic acid |
| InChIKey | NLYLKQOLEHUEKT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)