cas: 1170283-86-9 — see every product listed under this CAS number, including other names
2-Ethyl-1H,2H,3H,4H-benzo(b)1,6-naphthyridine-10-carboxylic acid hydrochloride, 95% (CAS 1170283-86-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1109265-10g |
| cas | 1170283-86-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln | |
| AmBeed | 5g | 10733.38 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid;hydrochloride (CAS 1170283-86-9) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: 2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid;hydrochloride. InChIKey: ZRSXCOSDEJMXFQ-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | 2-ethyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid;hydrochloride |
| InChIKey | ZRSXCOSDEJMXFQ-UHFFFAOYSA-N |
| SMILES | CCN1CCC2=NC3=CC=CC=C3C(=C2C1)C(=O)O.Cl |
Computed by PubChem (NCBI)