Products 1170595-16-0

CAS 1170595-16-0 is the registry number for 1-[(5-Chloro-1h-indol-3-yl)methyl]piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

1-[(5-chloro-1H-indol-3-yl)methyl]piperidine-4-carboxylic acid (CAS 1170595-16-0) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: 1-[(5-chloro-1H-indol-3-yl)methyl]piperidine-4-carboxylic acid. InChIKey: WOIDSYAPXMRFFF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17ClN2O2
Molecular weight292.76 g/mol
IUPAC name1-[(5-chloro-1H-indol-3-yl)methyl]piperidine-4-carboxylic acid
InChIKeyWOIDSYAPXMRFFF-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)CC2=CNC3=C2C=C(C=C3)Cl

Computed by PubChem (NCBI)