CAS 326407-32-3 appears in our catalog under these names: Benzyl 4-(aminomethyl)phenylcarbamate hydrochloride, 95%, Benzyl (4-(aminomethyl)phenyl)carbamate hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Benzyl N-[4-(aminomethyl)phenyl]carbamate;hydrochloride (CAS 326407-32-3) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: benzyl N-[4-(aminomethyl)phenyl]carbamate;hydrochloride. InChIKey: VQBSBPWUNQCZST-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | benzyl N-[4-(aminomethyl)phenyl]carbamate;hydrochloride |
| InChIKey | VQBSBPWUNQCZST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)