CAS 1171696-02-8 is the registry number for 4-Amino-N-(4-ethoxyphenyl)benzamide hydrochloride, 98+%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-N-(4-ethoxyphenyl)benzamide;hydrochloride (CAS 1171696-02-8) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 292.76 g/mol. IUPAC name: 4-amino-N-(4-ethoxyphenyl)benzamide;hydrochloride. InChIKey: WWDDSNHFQQTONS-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | 4-amino-N-(4-ethoxyphenyl)benzamide;hydrochloride |
| InChIKey | WWDDSNHFQQTONS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)