Products 1185117-79-6
CAS 1185117-79-6 appears in our catalog under these names: Climbazole-d4, Climbazole-d4, >95% (HPLC), (±)-Climbazole-d4 (phenyl-d4), 98 atom % D, min 98% Chemical Purity, (±)–Climbazole–d4, Climbazole-d4, 99.91%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 1 mg.
1-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one (CAS 1185117-79-6) is a chemical compound with the molecular formula C15H17ClN2O2 and a molecular weight of 296.78 g/mol. IUPAC name: 1-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one. InChIKey: OWEGWHBOCFMBLP-UGWFXTGHSA-N.
| Molecular formula | C15H17ClN2O2 |
|---|---|
| Molecular weight | 296.78 g/mol |
| IUPAC name | 1-(4-chloro-2,3,5,6-tetradeuteriophenoxy)-1-imidazol-1-yl-3,3-dimethylbutan-2-one |
| InChIKey | OWEGWHBOCFMBLP-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC(C(=O)C(C)(C)C)N2C=CN=C2)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)