cas: 34035-03-5 — see every product listed under this CAS number, including other names
2-FORMYL-5-(4-CHLOROPHENYL)FURAN, 97% (CAS 34035-03-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303088-5G |
| cas | 34035-03-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 289.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-(4-chlorophenyl)furan-2-carbaldehyde (CAS 34035-03-5) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 5-(4-chlorophenyl)furan-2-carbaldehyde. InChIKey: ROJGJNINTRCMBL-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 5-(4-chlorophenyl)furan-2-carbaldehyde |
| InChIKey | ROJGJNINTRCMBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C=O)Cl |
Computed by PubChem (NCBI)