cas: 34035-03-5 — see every product listed under this CAS number, including other names
5-(4-Chlorophenyl)furfural, 97%, 97% (CAS 34035-03-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11456T-1g |
| cas | 34035-03-5 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 50g | 318.80 Pln | |
| Chemat | 100g | 525.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-(4-chlorophenyl)furan-2-carbaldehyde (CAS 34035-03-5) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 5-(4-chlorophenyl)furan-2-carbaldehyde. InChIKey: ROJGJNINTRCMBL-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 5-(4-chlorophenyl)furan-2-carbaldehyde |
| InChIKey | ROJGJNINTRCMBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C=O)Cl |
Computed by PubChem (NCBI)