cas: 208173-19-7 — see every product listed under this CAS number, including other names
2-Fluoro-3-(trifluoromethyl)benzoyl chloride, 98% (CAS 208173-19-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006402-250MG |
| cas | 208173-19-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 565.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-fluoro-3-(trifluoromethyl)benzoyl chloride (CAS 208173-19-7) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzoyl chloride. InChIKey: RIKGRFSGIOOYEK-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethyl)benzoyl chloride |
| InChIKey | RIKGRFSGIOOYEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)