Products 261951-82-0

CAS 261951-82-0 appears in our catalog under these names: 3-Fluoro-2-(trifluoromethyl)benzoyl chloride, 95%, 3-Fluoro-2-(trifluoromethyl)benzoyl chloride, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-fluoro-2-(trifluoromethyl)benzoyl chloride (CAS 261951-82-0) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 3-fluoro-2-(trifluoromethyl)benzoyl chloride. InChIKey: FHWMGBNKQOJFOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClF4O
Molecular weight226.55 g/mol
IUPAC name3-fluoro-2-(trifluoromethyl)benzoyl chloride
InChIKeyFHWMGBNKQOJFOJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)C(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)