Products 207981-46-2

CAS 207981-46-2 appears in our catalog under these names: 2–Fluoro–5–(trifluoromethyl)benzoyl Chloride, 2-Fluoro-5-(trifluoromethyl)benzoyl chloride, 2-Fluoro-5-(trifluoromethyl)benzoyl chloride, 96%, 2-Fluoro-5-(trifluoromethyl)benzoyl chloride 98%, 2-Fluoro-5-(trifluoromethyl)benzoyl Chloride, >98.0%(T). Offered by: GLPBio, Fluorochem, Combi-blocks, Ambeed, TCI. Available pack sizes: 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-(trifluoromethyl)benzoyl chloride (CAS 207981-46-2) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)benzoyl chloride. InChIKey: OFVKAIZITGCCDN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClF4O
Molecular weight226.55 g/mol
IUPAC name2-fluoro-5-(trifluoromethyl)benzoyl chloride
InChIKeyOFVKAIZITGCCDN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)C(=O)Cl)F

Computed by PubChem (NCBI)