Products 109227-12-5

CAS 109227-12-5 appears in our catalog under these names: 2-Fluoro-6-(trifluoromethyl)benzoyl chloride, 97%, 2–Fluoro–6–(trifluoromethyl)benzoyl Chloride, 2-Fluoro-6-(trifluoromethyl)benzoylchloride 98%, 2-Fluoro-6-(trifluoromethyl)benzoyl chloride. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.

Structural formula: {0} (CAS {1})

2-fluoro-6-(trifluoromethyl)benzoyl chloride (CAS 109227-12-5) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-6-(trifluoromethyl)benzoyl chloride. InChIKey: ZDRYDSJMVRRAAF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClF4O
Molecular weight226.55 g/mol
IUPAC name2-fluoro-6-(trifluoromethyl)benzoyl chloride
InChIKeyZDRYDSJMVRRAAF-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)C(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)