CAS 109227-12-5 appears in our catalog under these names: 2-Fluoro-6-(trifluoromethyl)benzoyl chloride, 97%, 2–Fluoro–6–(trifluoromethyl)benzoyl Chloride, 2-Fluoro-6-(trifluoromethyl)benzoylchloride 98%, 2-Fluoro-6-(trifluoromethyl)benzoyl chloride. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.
2-fluoro-6-(trifluoromethyl)benzoyl chloride (CAS 109227-12-5) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-6-(trifluoromethyl)benzoyl chloride. InChIKey: ZDRYDSJMVRRAAF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 2-fluoro-6-(trifluoromethyl)benzoyl chloride |
| InChIKey | ZDRYDSJMVRRAAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)