Products 208173-19-7

CAS 208173-19-7 appears in our catalog under these names: 2-Fluoro-3-(trifluoromethyl)benzoyl chloride, 95%, 2–Fluoro–3–(trifluoromethyl)benzoyl Chloride, 2-Fluoro-3-(trifluoromethyl)benzoyl chloride 98%, 2-Fluoro-3-(trifluoromethyl)benzoyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-3-(trifluoromethyl)benzoyl chloride (CAS 208173-19-7) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzoyl chloride. InChIKey: RIKGRFSGIOOYEK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3ClF4O
Molecular weight226.55 g/mol
IUPAC name2-fluoro-3-(trifluoromethyl)benzoyl chloride
InChIKeyRIKGRFSGIOOYEK-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)Cl

Computed by PubChem (NCBI)