CAS 208173-19-7 appears in our catalog under these names: 2-Fluoro-3-(trifluoromethyl)benzoyl chloride, 95%, 2–Fluoro–3–(trifluoromethyl)benzoyl Chloride, 2-Fluoro-3-(trifluoromethyl)benzoyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g, 250mg.
2-fluoro-3-(trifluoromethyl)benzoyl chloride (CAS 208173-19-7) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 2-fluoro-3-(trifluoromethyl)benzoyl chloride. InChIKey: RIKGRFSGIOOYEK-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 2-fluoro-3-(trifluoromethyl)benzoyl chloride |
| InChIKey | RIKGRFSGIOOYEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)Cl |
Computed by PubChem (NCBI)