CAS 1431329-67-7 is the registry number for 4-Chloro-3-fluoro-5-(trifluoromethyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
4-chloro-3-fluoro-5-(trifluoromethyl)benzaldehyde (CAS 1431329-67-7) is a chemical compound with the molecular formula C8H3ClF4O and a molecular weight of 226.55 g/mol. IUPAC name: 4-chloro-3-fluoro-5-(trifluoromethyl)benzaldehyde. InChIKey: ZRWYPNUFFZTHOX-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF4O |
|---|---|
| Molecular weight | 226.55 g/mol |
| IUPAC name | 4-chloro-3-fluoro-5-(trifluoromethyl)benzaldehyde |
| InChIKey | ZRWYPNUFFZTHOX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)F)C=O |
Computed by PubChem (NCBI)